C21H32FN3O2 — CID 134111495
N'-(3-ethoxypropyl)-N-(5-fluoro-2-hydroxyphenyl)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carboximidamide (PubChem CID 134111495) has the molecular formula C21H32FN3O2 and a molecular weight of 377.50 g/mol. Its IUPAC name is N'-(3-ethoxypropyl)-N-(5-fluoro-2-hydroxyphenyl)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carboximidamide.
| Compound Name | N'-(3-ethoxypropyl)-N-(5-fluoro-2-hydroxyphenyl)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carboximidamide |
|---|---|
| PubChem CID | 134111495 |
| Molecular Formula | C21H32FN3O2 |
| Molecular Weight | 377.50 g/mol |
| Exact Mass | 377.25 |
| IUPAC Name | N'-(3-ethoxypropyl)-N-(5-fluoro-2-hydroxyphenyl)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carboximidamide |
| SMILES | CCOCCC/N=C(\Nc1cc(F)ccc1O)N1CCCC2CCCCC21 |
| InChI | InChI=1S/C21H32FN3O2/c1-2-27-14-6-12-23-21(24-18-15-17(22)10-11-20(18)26)25-13-5-8-16-7-3-4-9-19(16)25/h10-11,15-16,19,26H,2-9,12-14H2,1H3,(H,23,24) |
| InChIKey | XKYMBBBZFUATRR-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 57.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.50 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|