C15H31N5O — CID 104884316
N-amino-4-cyclopentyl-N'-(3-ethoxypropyl)piperazine-1-carboximidamide (PubChem CID 104884316) has the molecular formula C15H31N5O and a molecular weight of 297.45 g/mol. Its IUPAC name is N-amino-4-cyclopentyl-N'-(3-ethoxypropyl)piperazine-1-carboximidamide.
| Compound Name | N-amino-4-cyclopentyl-N'-(3-ethoxypropyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 104884316 |
| Molecular Formula | C15H31N5O |
| Molecular Weight | 297.45 g/mol |
| Exact Mass | 297.25 |
| IUPAC Name | N-amino-4-cyclopentyl-N'-(3-ethoxypropyl)piperazine-1-carboximidamide |
| SMILES | CCOCCC/N=C(\NN)N1CCN(C2CCCC2)CC1 |
| InChI | InChI=1S/C15H31N5O/c1-2-21-13-5-8-17-15(18-16)20-11-9-19(10-12-20)14-6-3-4-7-14/h14H,2-13,16H2,1H3,(H,17,18) |
| InChIKey | ILGVMCUMIUIGRA-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 66.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.45 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|