C16H26N4O — CID 116513545
N-amino-N'-(3-ethoxypropyl)-3-phenylpyrrolidine-1-carboximidamide (PubChem CID 116513545) has the molecular formula C16H26N4O and a molecular weight of 290.41 g/mol. Its IUPAC name is N-amino-N'-(3-ethoxypropyl)-3-phenylpyrrolidine-1-carboximidamide.
| Compound Name | N-amino-N'-(3-ethoxypropyl)-3-phenylpyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 116513545 |
| Molecular Formula | C16H26N4O |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.21 |
| IUPAC Name | N-amino-N'-(3-ethoxypropyl)-3-phenylpyrrolidine-1-carboximidamide |
| SMILES | CCOCCC/N=C(\NN)N1CCC(c2ccccc2)C1 |
| InChI | InChI=1S/C16H26N4O/c1-2-21-12-6-10-18-16(19-17)20-11-9-15(13-20)14-7-4-3-5-8-14/h3-5,7-8,15H,2,6,9-13,17H2,1H3,(H,18,19) |
| InChIKey | SJNDSCVEYCJRIW-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|