C19H29N3O2 — CID 111723371
ethyl 4-[[ethylamino-(3-phenylpyrrolidin-1-yl)methylidene]amino]butanoate (PubChem CID 111723371) has the molecular formula C19H29N3O2 and a molecular weight of 331.46 g/mol. Its IUPAC name is ethyl 4-[[ethylamino-(3-phenylpyrrolidin-1-yl)methylidene]amino]butanoate.
| Compound Name | ethyl 4-[[ethylamino-(3-phenylpyrrolidin-1-yl)methylidene]amino]butanoate |
|---|---|
| PubChem CID | 111723371 |
| Molecular Formula | C19H29N3O2 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.23 |
| IUPAC Name | ethyl 4-[[ethylamino-(3-phenylpyrrolidin-1-yl)methylidene]amino]butanoate |
| SMILES | CCN/C(=N\CCCC(=O)OCC)N1CCC(c2ccccc2)C1 |
| InChI | InChI=1S/C19H29N3O2/c1-3-20-19(21-13-8-11-18(23)24-4-2)22-14-12-17(15-22)16-9-6-5-7-10-16/h5-7,9-10,17H,3-4,8,11-15H2,1-2H3,(H,20,21) |
| InChIKey | MEJKJUHQFGJWQL-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|