C14H22N4 — CID 116513546
N-amino-3-phenyl-N'-propylpyrrolidine-1-carboximidamide (PubChem CID 116513546) has the molecular formula C14H22N4 and a molecular weight of 246.36 g/mol. Its IUPAC name is N-amino-3-phenyl-N'-propylpyrrolidine-1-carboximidamide.
| Compound Name | N-amino-3-phenyl-N'-propylpyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 116513546 |
| Molecular Formula | C14H22N4 |
| Molecular Weight | 246.36 g/mol |
| Exact Mass | 246.18 |
| IUPAC Name | N-amino-3-phenyl-N'-propylpyrrolidine-1-carboximidamide |
| SMILES | CCC/N=C(\NN)N1CCC(c2ccccc2)C1 |
| InChI | InChI=1S/C14H22N4/c1-2-9-16-14(17-15)18-10-8-13(11-18)12-6-4-3-5-7-12/h3-7,13H,2,8-11,15H2,1H3,(H,16,17) |
| InChIKey | VYVYKIKKTZQYEN-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.36 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|