C12H26N4OS — CID 104888829
N-amino-N'-(3-ethoxypropyl)-2,3-dimethylthiomorpholine-4-carboximidamide (PubChem CID 104888829) has the molecular formula C12H26N4OS and a molecular weight of 274.43 g/mol. Its IUPAC name is N-amino-N'-(3-ethoxypropyl)-2,3-dimethylthiomorpholine-4-carboximidamide.
| Compound Name | N-amino-N'-(3-ethoxypropyl)-2,3-dimethylthiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 104888829 |
| Molecular Formula | C12H26N4OS |
| Molecular Weight | 274.43 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | N-amino-N'-(3-ethoxypropyl)-2,3-dimethylthiomorpholine-4-carboximidamide |
| SMILES | CCOCCC/N=C(\NN)N1CCSC(C)C1C |
| InChI | InChI=1S/C12H26N4OS/c1-4-17-8-5-6-14-12(15-13)16-7-9-18-11(3)10(16)2/h10-11H,4-9,13H2,1-3H3,(H,14,15) |
| InChIKey | DSBMIHJXOONGTN-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.43 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|