C18H29FN4O2 — CID 134111496
N'-(3-ethoxypropyl)-N-(5-fluoro-2-hydroxyphenyl)-3,5-dimethylpiperazine-1-carboximidamide (PubChem CID 134111496) has the molecular formula C18H29FN4O2 and a molecular weight of 352.45 g/mol. Its IUPAC name is N'-(3-ethoxypropyl)-N-(5-fluoro-2-hydroxyphenyl)-3,5-dimethylpiperazine-1-carboximidamide.
| Compound Name | N'-(3-ethoxypropyl)-N-(5-fluoro-2-hydroxyphenyl)-3,5-dimethylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 134111496 |
| Molecular Formula | C18H29FN4O2 |
| Molecular Weight | 352.45 g/mol |
| Exact Mass | 352.23 |
| IUPAC Name | N'-(3-ethoxypropyl)-N-(5-fluoro-2-hydroxyphenyl)-3,5-dimethylpiperazine-1-carboximidamide |
| SMILES | CCOCCC/N=C(/Nc1cc(F)ccc1O)N1CC(C)NC(C)C1 |
| InChI | InChI=1S/C18H29FN4O2/c1-4-25-9-5-8-20-18(23-11-13(2)21-14(3)12-23)22-16-10-15(19)6-7-17(16)24/h6-7,10,13-14,21,24H,4-5,8-9,11-12H2,1-3H3,(H,20,22) |
| InChIKey | OYZRTKHQWXNLDB-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.45 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|