C22H23N3O2S — CID 134121712
N-(2-hydroxy-5-phenylphenyl)-N'-(thiophen-2-ylmethyl)morpholine-4-carboximidamide (PubChem CID 134121712) has the molecular formula C22H23N3O2S and a molecular weight of 393.51 g/mol. Its IUPAC name is N-(2-hydroxy-5-phenylphenyl)-N'-(thiophen-2-ylmethyl)morpholine-4-carboximidamide.
| Compound Name | N-(2-hydroxy-5-phenylphenyl)-N'-(thiophen-2-ylmethyl)morpholine-4-carboximidamide |
|---|---|
| PubChem CID | 134121712 |
| Molecular Formula | C22H23N3O2S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | N-(2-hydroxy-5-phenylphenyl)-N'-(thiophen-2-ylmethyl)morpholine-4-carboximidamide |
| SMILES | Oc1ccc(-c2ccccc2)cc1N/C(=N/Cc1cccs1)N1CCOCC1 |
| InChI | InChI=1S/C22H23N3O2S/c26-21-9-8-18(17-5-2-1-3-6-17)15-20(21)24-22(25-10-12-27-13-11-25)23-16-19-7-4-14-28-19/h1-9,14-15,26H,10-13,16H2,(H,23,24) |
| InChIKey | RGOAMWIZZVHDMB-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 57.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|