C22H32IN5O3S — CID 111367602
N-[2-(furan-2-yl)ethyl]-4-(2-morpholin-4-yl-2-oxoethyl)-N'-(thiophen-2-ylmethyl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 111367602) has the molecular formula C22H32IN5O3S and a molecular weight of 573.50 g/mol. Its IUPAC name is N-[2-(furan-2-yl)ethyl]-4-(2-morpholin-4-yl-2-oxoethyl)-N'-(thiophen-2-ylmethyl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-[2-(furan-2-yl)ethyl]-4-(2-morpholin-4-yl-2-oxoethyl)-N'-(thiophen-2-ylmethyl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111367602 |
| Molecular Formula | C22H32IN5O3S |
| Molecular Weight | 573.50 g/mol |
| Exact Mass | 573.13 |
| IUPAC Name | N-[2-(furan-2-yl)ethyl]-4-(2-morpholin-4-yl-2-oxoethyl)-N'-(thiophen-2-ylmethyl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | I.O=C(CN1CCN(/C(=N/Cc2cccs2)NCCc2ccco2)CC1)N1CCOCC1 |
| InChI | InChI=1S/C22H31N5O3S.HI/c28-21(26-11-14-29-15-12-26)18-25-7-9-27(10-8-25)22(24-17-20-4-2-16-31-20)23-6-5-19-3-1-13-30-19;/h1-4,13,16H,5-12,14-15,17-18H2,(H,23,24);1H |
| InChIKey | YHZHXQYKXVWXDX-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 73.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.50 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|