C20H28IN3O3S — CID 110059075
N-[2-(furan-2-yl)ethyl]-2-(oxolan-2-yl)-N'-(thiophen-2-ylmethyl)morpholine-4-carboximidamide;hydroiodide (PubChem CID 110059075) has the molecular formula C20H28IN3O3S and a molecular weight of 517.43 g/mol. Its IUPAC name is N-[2-(furan-2-yl)ethyl]-2-(oxolan-2-yl)-N'-(thiophen-2-ylmethyl)morpholine-4-carboximidamide;hydroiodide.
| Compound Name | N-[2-(furan-2-yl)ethyl]-2-(oxolan-2-yl)-N'-(thiophen-2-ylmethyl)morpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 110059075 |
| Molecular Formula | C20H28IN3O3S |
| Molecular Weight | 517.43 g/mol |
| Exact Mass | 517.09 |
| IUPAC Name | N-[2-(furan-2-yl)ethyl]-2-(oxolan-2-yl)-N'-(thiophen-2-ylmethyl)morpholine-4-carboximidamide;hydroiodide |
| SMILES | I.c1coc(CCN/C(=N\Cc2cccs2)N2CCOC(C3CCCO3)C2)c1 |
| InChI | InChI=1S/C20H27N3O3S.HI/c1-4-16(24-10-1)7-8-21-20(22-14-17-5-3-13-27-17)23-9-12-26-19(15-23)18-6-2-11-25-18;/h1,3-5,10,13,18-19H,2,6-9,11-12,14-15H2,(H,21,22);1H |
| InChIKey | QJUHHLSRRNEDOW-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 59.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.43 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|