C20H31N3O4 — CID 110059054
N-[2-(furan-2-yl)ethyl]-2-(oxolan-2-yl)-N'-(oxolan-3-ylmethyl)morpholine-4-carboximidamide (PubChem CID 110059054) has the molecular formula C20H31N3O4 and a molecular weight of 377.49 g/mol. Its IUPAC name is N-[2-(furan-2-yl)ethyl]-2-(oxolan-2-yl)-N'-(oxolan-3-ylmethyl)morpholine-4-carboximidamide.
| Compound Name | N-[2-(furan-2-yl)ethyl]-2-(oxolan-2-yl)-N'-(oxolan-3-ylmethyl)morpholine-4-carboximidamide |
|---|---|
| PubChem CID | 110059054 |
| Molecular Formula | C20H31N3O4 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.23 |
| IUPAC Name | N-[2-(furan-2-yl)ethyl]-2-(oxolan-2-yl)-N'-(oxolan-3-ylmethyl)morpholine-4-carboximidamide |
| SMILES | c1coc(CCN/C(=N\CC2CCOC2)N2CCOC(C3CCCO3)C2)c1 |
| InChI | InChI=1S/C20H31N3O4/c1-3-17(25-9-1)5-7-21-20(22-13-16-6-11-24-15-16)23-8-12-27-19(14-23)18-4-2-10-26-18/h1,3,9,16,18-19H,2,4-8,10-15H2,(H,21,22) |
| InChIKey | IZTNYZOZDLUPAR-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 68.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|