C21H29N3O3S — CID 110059078
N-[2-(furan-2-yl)ethyl]-2-(oxolan-2-yl)-N'-(2-thiophen-2-ylethyl)morpholine-4-carboximidamide (PubChem CID 110059078) has the molecular formula C21H29N3O3S and a molecular weight of 403.55 g/mol. Its IUPAC name is N-[2-(furan-2-yl)ethyl]-2-(oxolan-2-yl)-N'-(2-thiophen-2-ylethyl)morpholine-4-carboximidamide.
| Compound Name | N-[2-(furan-2-yl)ethyl]-2-(oxolan-2-yl)-N'-(2-thiophen-2-ylethyl)morpholine-4-carboximidamide |
|---|---|
| PubChem CID | 110059078 |
| Molecular Formula | C21H29N3O3S |
| Molecular Weight | 403.55 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | N-[2-(furan-2-yl)ethyl]-2-(oxolan-2-yl)-N'-(2-thiophen-2-ylethyl)morpholine-4-carboximidamide |
| SMILES | c1coc(CCN/C(=N\CCc2cccs2)N2CCOC(C3CCCO3)C2)c1 |
| InChI | InChI=1S/C21H29N3O3S/c1-4-17(25-12-1)7-9-22-21(23-10-8-18-5-3-15-28-18)24-11-14-27-20(16-24)19-6-2-13-26-19/h1,3-5,12,15,19-20H,2,6-11,13-14,16H2,(H,22,23) |
| InChIKey | SFHOSEMLKKLAFH-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 59.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.55 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|