C20H28N4O2S — CID 110058164
2-[1-[N-[2-(furan-2-yl)ethyl]-N'-(2-thiophen-2-ylethyl)carbamimidoyl]piperidin-3-yl]acetamide (PubChem CID 110058164) has the molecular formula C20H28N4O2S and a molecular weight of 388.54 g/mol. Its IUPAC name is 2-[1-[N-[2-(furan-2-yl)ethyl]-N'-(2-thiophen-2-ylethyl)carbamimidoyl]piperidin-3-yl]acetamide.
| Compound Name | 2-[1-[N-[2-(furan-2-yl)ethyl]-N'-(2-thiophen-2-ylethyl)carbamimidoyl]piperidin-3-yl]acetamide |
|---|---|
| PubChem CID | 110058164 |
| Molecular Formula | C20H28N4O2S |
| Molecular Weight | 388.54 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | 2-[1-[N-[2-(furan-2-yl)ethyl]-N'-(2-thiophen-2-ylethyl)carbamimidoyl]piperidin-3-yl]acetamide |
| SMILES | NC(=O)CC1CCCN(/C(=N/CCc2cccs2)NCCc2ccco2)C1 |
| InChI | InChI=1S/C20H28N4O2S/c21-19(25)14-16-4-1-11-24(15-16)20(22-9-7-17-5-2-12-26-17)23-10-8-18-6-3-13-27-18/h2-3,5-6,12-13,16H,1,4,7-11,14-15H2,(H2,21,25)(H,22,23) |
| InChIKey | FMIVAINTAYFJQI-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 83.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.54 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|