C24H34N4O2 — CID 110061104
4-(3,4-dimethylphenyl)-N-[2-(furan-2-yl)ethyl]-N'-(oxolan-3-ylmethyl)piperazine-1-carboximidamide (PubChem CID 110061104) has the molecular formula C24H34N4O2 and a molecular weight of 410.56 g/mol. Its IUPAC name is 4-(3,4-dimethylphenyl)-N-[2-(furan-2-yl)ethyl]-N'-(oxolan-3-ylmethyl)piperazine-1-carboximidamide.
| Compound Name | 4-(3,4-dimethylphenyl)-N-[2-(furan-2-yl)ethyl]-N'-(oxolan-3-ylmethyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 110061104 |
| Molecular Formula | C24H34N4O2 |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.27 |
| IUPAC Name | 4-(3,4-dimethylphenyl)-N-[2-(furan-2-yl)ethyl]-N'-(oxolan-3-ylmethyl)piperazine-1-carboximidamide |
| SMILES | Cc1ccc(N2CCN(/C(=N/CC3CCOC3)NCCc3ccco3)CC2)cc1C |
| InChI | InChI=1S/C24H34N4O2/c1-19-5-6-22(16-20(19)2)27-10-12-28(13-11-27)24(26-17-21-8-15-29-18-21)25-9-7-23-4-3-14-30-23/h3-6,14,16,21H,7-13,15,17-18H2,1-2H3,(H,25,26) |
| InChIKey | UDRDYIRZHSEOQV-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 53.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|