C21H34F3IN4O2 — CID 110056547
3-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]-N-[2-(furan-2-yl)ethyl]-N'-(oxolan-3-ylmethyl)pyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 110056547) has the molecular formula C21H34F3IN4O2 and a molecular weight of 558.43 g/mol. Its IUPAC name is 3-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]-N-[2-(furan-2-yl)ethyl]-N'-(oxolan-3-ylmethyl)pyrrolidine-1-carboximidamide;hydroiodide.
| Compound Name | 3-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]-N-[2-(furan-2-yl)ethyl]-N'-(oxolan-3-ylmethyl)pyrrolidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 110056547 |
| Molecular Formula | C21H34F3IN4O2 |
| Molecular Weight | 558.43 g/mol |
| Exact Mass | 558.17 |
| IUPAC Name | 3-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]-N-[2-(furan-2-yl)ethyl]-N'-(oxolan-3-ylmethyl)pyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | CCN(CC1CCN(/C(=N/CC2CCOC2)NCCc2ccco2)C1)CC(F)(F)F.I |
| InChI | InChI=1S/C21H33F3N4O2.HI/c1-2-27(16-21(22,23)24)13-18-6-9-28(14-18)20(26-12-17-7-11-29-15-17)25-8-5-19-4-3-10-30-19;/h3-4,10,17-18H,2,5-9,11-16H2,1H3,(H,25,26);1H |
| InChIKey | SEVBNTQTKOVAGZ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 53.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.43 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|