C21H35N3O2 — CID 134091720
1-(5-tert-butyl-2-hydroxyphenyl)-3-cycloheptyl-2-(2-methoxyethyl)guanidine (PubChem CID 134091720) has the molecular formula C21H35N3O2 and a molecular weight of 361.53 g/mol. Its IUPAC name is 1-(5-tert-butyl-2-hydroxyphenyl)-3-cycloheptyl-2-(2-methoxyethyl)guanidine.
| Compound Name | 1-(5-tert-butyl-2-hydroxyphenyl)-3-cycloheptyl-2-(2-methoxyethyl)guanidine |
|---|---|
| PubChem CID | 134091720 |
| Molecular Formula | C21H35N3O2 |
| Molecular Weight | 361.53 g/mol |
| Exact Mass | 361.27 |
| IUPAC Name | 1-(5-tert-butyl-2-hydroxyphenyl)-3-cycloheptyl-2-(2-methoxyethyl)guanidine |
| SMILES | COCC/N=C(/Nc1cc(C(C)(C)C)ccc1O)NC1CCCCCC1 |
| InChI | InChI=1S/C21H35N3O2/c1-21(2,3)16-11-12-19(25)18(15-16)24-20(22-13-14-26-4)23-17-9-7-5-6-8-10-17/h11-12,15,17,25H,5-10,13-14H2,1-4H3,(H2,22,23,24) |
| InChIKey | BFVJGQYEKIYPEB-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.53 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|