C25H29N3O — CID 134121850
1-(5-tert-butyl-2-hydroxyphenyl)-3-cyclopropyl-2-(naphthalen-1-ylmethyl)guanidine (PubChem CID 134121850) has the molecular formula C25H29N3O and a molecular weight of 387.53 g/mol. Its IUPAC name is 1-(5-tert-butyl-2-hydroxyphenyl)-3-cyclopropyl-2-(naphthalen-1-ylmethyl)guanidine.
| Compound Name | 1-(5-tert-butyl-2-hydroxyphenyl)-3-cyclopropyl-2-(naphthalen-1-ylmethyl)guanidine |
|---|---|
| PubChem CID | 134121850 |
| Molecular Formula | C25H29N3O |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.23 |
| IUPAC Name | 1-(5-tert-butyl-2-hydroxyphenyl)-3-cyclopropyl-2-(naphthalen-1-ylmethyl)guanidine |
| SMILES | CC(C)(C)c1ccc(O)c(N/C(=N/Cc2cccc3ccccc23)NC2CC2)c1 |
| InChI | InChI=1S/C25H29N3O/c1-25(2,3)19-11-14-23(29)22(15-19)28-24(27-20-12-13-20)26-16-18-9-6-8-17-7-4-5-10-21(17)18/h4-11,14-15,20,29H,12-13,16H2,1-3H3,(H2,26,27,28) |
| InChIKey | FGFIKLIDWDIGTO-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|