C21H27NO4 — CID 139011848
N-(5-tert-butyl-2-hydroxyphenyl)-3-(3-methoxypropoxy)benzamide (PubChem CID 139011848) has the molecular formula C21H27NO4 and a molecular weight of 357.45 g/mol. Its IUPAC name is N-(5-tert-butyl-2-hydroxyphenyl)-3-(3-methoxypropoxy)benzamide.
| Compound Name | N-(5-tert-butyl-2-hydroxyphenyl)-3-(3-methoxypropoxy)benzamide |
|---|---|
| PubChem CID | 139011848 |
| Molecular Formula | C21H27NO4 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | N-(5-tert-butyl-2-hydroxyphenyl)-3-(3-methoxypropoxy)benzamide |
| SMILES | COCCCOc1cccc(C(=O)Nc2cc(C(C)(C)C)ccc2O)c1 |
| InChI | InChI=1S/C21H27NO4/c1-21(2,3)16-9-10-19(23)18(14-16)22-20(24)15-7-5-8-17(13-15)26-12-6-11-25-4/h5,7-10,13-14,23H,6,11-12H2,1-4H3,(H,22,24) |
| InChIKey | RLDHMAGBBYREQH-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|