C17H28O — CID 174535578
4-tert-butyl-2-cyclohexylphenol;methane (PubChem CID 174535578) has the molecular formula C17H28O and a molecular weight of 248.41 g/mol. Its IUPAC name is 4-tert-butyl-2-cyclohexylphenol;methane.
| Compound Name | 4-tert-butyl-2-cyclohexylphenol;methane |
|---|---|
| PubChem CID | 174535578 |
| Molecular Formula | C17H28O |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.21 |
| IUPAC Name | 4-tert-butyl-2-cyclohexylphenol;methane |
| SMILES | C.CC(C)(C)c1ccc(O)c(C2CCCCC2)c1 |
| InChI | InChI=1S/C16H24O.CH4/c1-16(2,3)13-9-10-15(17)14(11-13)12-7-5-4-6-8-12;/h9-12,17H,4-8H2,1-3H3;1H4 |
| InChIKey | HYNUKFDHUGZQQT-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |