C27H33Cl2F2N5O — CID 11455660
N-[2-(2,4-dichlorophenyl)ethyl]-4-[[N-(4,4-difluorocyclohexyl)-C-[(3S)-3-methylpiperazin-1-yl]carbonimidoyl]amino]benzamide (PubChem CID 11455660) has the molecular formula C27H33Cl2F2N5O and a molecular weight of 552.50 g/mol. Its IUPAC name is N-[2-(2,4-dichlorophenyl)ethyl]-4-[[N-(4,4-difluorocyclohexyl)-C-[(3S)-3-methylpiperazin-1-yl]carbonimidoyl]amino]benzamide.
| Compound Name | N-[2-(2,4-dichlorophenyl)ethyl]-4-[[N-(4,4-difluorocyclohexyl)-C-[(3S)-3-methylpiperazin-1-yl]carbonimidoyl]amino]benzamide |
|---|---|
| PubChem CID | 11455660 |
| Molecular Formula | C27H33Cl2F2N5O |
| Molecular Weight | 552.50 g/mol |
| Exact Mass | 551.20 |
| IUPAC Name | N-[2-(2,4-dichlorophenyl)ethyl]-4-[[N-(4,4-difluorocyclohexyl)-C-[(3S)-3-methylpiperazin-1-yl]carbonimidoyl]amino]benzamide |
| SMILES | C[C@H]1CN(/C(=N\C2CCC(F)(F)CC2)Nc2ccc(C(=O)NCCc3ccc(Cl)cc3Cl)cc2)CCN1 |
| InChI | InChI=1S/C27H33Cl2F2N5O/c1-18-17-36(15-14-32-18)26(35-23-8-11-27(30,31)12-9-23)34-22-6-3-20(4-7-22)25(37)33-13-10-19-2-5-21(28)16-24(19)29/h2-7,16,18,23,32H,8-15,17H2,1H3,(H,33,37)(H,34,35)/t18-/m0/s1 |
| InChIKey | ZHBKUMHQVVLFSS-SFHVURJKSA-N |
| XLogP | 5.61 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.50 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|