C28H37Cl2N5O — CID 68892451
3-(2,4-dichlorophenyl)-3-[4-[[N-[(1R,2R)-2-methylcyclohexyl]-C-[(3S)-3-methylpiperazin-1-yl]carbonimidoyl]amino]phenyl]propanamide (PubChem CID 68892451) has the molecular formula C28H37Cl2N5O and a molecular weight of 530.54 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-3-[4-[[N-[(1R,2R)-2-methylcyclohexyl]-C-[(3S)-3-methylpiperazin-1-yl]carbonimidoyl]amino]phenyl]propanamide.
| Compound Name | 3-(2,4-dichlorophenyl)-3-[4-[[N-[(1R,2R)-2-methylcyclohexyl]-C-[(3S)-3-methylpiperazin-1-yl]carbonimidoyl]amino]phenyl]propanamide |
|---|---|
| PubChem CID | 68892451 |
| Molecular Formula | C28H37Cl2N5O |
| Molecular Weight | 530.54 g/mol |
| Exact Mass | 529.24 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-3-[4-[[N-[(1R,2R)-2-methylcyclohexyl]-C-[(3S)-3-methylpiperazin-1-yl]carbonimidoyl]amino]phenyl]propanamide |
| SMILES | C[C@@H]1CCCC[C@H]1/N=C(/Nc1ccc(C(CC(N)=O)c2ccc(Cl)cc2Cl)cc1)N1CCN[C@@H](C)C1 |
| InChI | InChI=1S/C28H37Cl2N5O/c1-18-5-3-4-6-26(18)34-28(35-14-13-32-19(2)17-35)33-22-10-7-20(8-11-22)24(16-27(31)36)23-12-9-21(29)15-25(23)30/h7-12,15,18-19,24,26,32H,3-6,13-14,16-17H2,1-2H3,(H2,31,36)(H,33,34)/t18-,19+,24?,26-/m1/s1 |
| InChIKey | XOZQISNIYFDIFP-XIZMONNESA-N |
| XLogP | 5.64 |
| TPSA | 82.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.54 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|