C32H43Cl2N5O — CID 68889535
3-(2,4-dichlorophenyl)-3-[4-[[C-(3,5-dimethylpiperazin-1-yl)-N-(2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl)carbonimidoyl]amino]phenyl]propanamide (PubChem CID 68889535) has the molecular formula C32H43Cl2N5O and a molecular weight of 584.64 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-3-[4-[[C-(3,5-dimethylpiperazin-1-yl)-N-(2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl)carbonimidoyl]amino]phenyl]propanamide.
| Compound Name | 3-(2,4-dichlorophenyl)-3-[4-[[C-(3,5-dimethylpiperazin-1-yl)-N-(2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl)carbonimidoyl]amino]phenyl]propanamide |
|---|---|
| PubChem CID | 68889535 |
| Molecular Formula | C32H43Cl2N5O |
| Molecular Weight | 584.64 g/mol |
| Exact Mass | 583.28 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-3-[4-[[C-(3,5-dimethylpiperazin-1-yl)-N-(2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl)carbonimidoyl]amino]phenyl]propanamide |
| SMILES | CC1CN(/C(=N/C2CC3CC(C2C)C3(C)C)Nc2ccc(C(CC(N)=O)c3ccc(Cl)cc3Cl)cc2)CC(C)N1 |
| InChI | InChI=1S/C32H43Cl2N5O/c1-18-16-39(17-19(2)36-18)31(38-29-13-22-12-27(20(29)3)32(22,4)5)37-24-9-6-21(7-10-24)26(15-30(35)40)25-11-8-23(33)14-28(25)34/h6-11,14,18-20,22,26-27,29,36H,12-13,15-17H2,1-5H3,(H2,35,40)(H,37,38) |
| InChIKey | IENYOMSYIMBUBJ-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 82.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.64 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|