C33H46FN5O2 — CID 24848936
4-[[C-(3,5-dimethylpiperazin-1-yl)-N-[(1S,2S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]carbonimidoyl]amino]-N-[2-(2-fluoro-4-methoxyphenyl)ethyl]benzamide (PubChem CID 24848936) has the molecular formula C33H46FN5O2 and a molecular weight of 563.76 g/mol. Its IUPAC name is 4-[[C-(3,5-dimethylpiperazin-1-yl)-N-[(1S,2S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]carbonimidoyl]amino]-N-[2-(2-fluoro-4-methoxyphenyl)ethyl]benzamide.
| Compound Name | 4-[[C-(3,5-dimethylpiperazin-1-yl)-N-[(1S,2S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]carbonimidoyl]amino]-N-[2-(2-fluoro-4-methoxyphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 24848936 |
| Molecular Formula | C33H46FN5O2 |
| Molecular Weight | 563.76 g/mol |
| Exact Mass | 563.36 |
| IUPAC Name | 4-[[C-(3,5-dimethylpiperazin-1-yl)-N-[(1S,2S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]carbonimidoyl]amino]-N-[2-(2-fluoro-4-methoxyphenyl)ethyl]benzamide |
| SMILES | COc1ccc(CCNC(=O)c2ccc(N/C(=N\C3C[C@H]4C[C@@H]([C@@H]3C)C4(C)C)N3CC(C)NC(C)C3)cc2)c(F)c1 |
| InChI | InChI=1S/C33H46FN5O2/c1-20-18-39(19-21(2)36-20)32(38-30-16-25-15-28(22(30)3)33(25,4)5)37-26-10-7-24(8-11-26)31(40)35-14-13-23-9-12-27(41-6)17-29(23)34/h7-12,17,20-22,25,28,30,36H,13-16,18-19H2,1-6H3,(H,35,40)(H,37,38)/t20?,21?,22-,25+,28-,30?/m0/s1 |
| InChIKey | RVOITWGTMMYROF-OGUNGUFNSA-N |
| XLogP | 5.33 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.76 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|