C26H33Cl2N7O2 — CID 161046571
4-[[(4-tert-butylcyclohexyl)-[(3,5-dichlorophenyl)carbamoyl]amino]methyl]-N-(N-hydrazinylidenecarbamimidoyl)benzamide (PubChem CID 161046571) has the molecular formula C26H33Cl2N7O2 and a molecular weight of 546.50 g/mol. Its IUPAC name is 4-[[(4-tert-butylcyclohexyl)-[(3,5-dichlorophenyl)carbamoyl]amino]methyl]-N-(N-hydrazinylidenecarbamimidoyl)benzamide.
| Compound Name | 4-[[(4-tert-butylcyclohexyl)-[(3,5-dichlorophenyl)carbamoyl]amino]methyl]-N-(N-hydrazinylidenecarbamimidoyl)benzamide |
|---|---|
| PubChem CID | 161046571 |
| Molecular Formula | C26H33Cl2N7O2 |
| Molecular Weight | 546.50 g/mol |
| Exact Mass | 545.21 |
| IUPAC Name | 4-[[(4-tert-butylcyclohexyl)-[(3,5-dichlorophenyl)carbamoyl]amino]methyl]-N-(N-hydrazinylidenecarbamimidoyl)benzamide |
| SMILES | [H]/N=C(\N=NN)NC(=O)c1ccc(CN(C(=O)Nc2cc(Cl)cc(Cl)c2)C2CCC(C(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C26H33Cl2N7O2/c1-26(2,3)18-8-10-22(11-9-18)35(25(37)31-21-13-19(27)12-20(28)14-21)15-16-4-6-17(7-5-16)23(36)32-24(29)33-34-30/h4-7,12-14,18,22H,8-11,15H2,1-3H3,(H,31,37)(H4,29,30,32,33,36) |
| InChIKey | UBORPTOJQVRXSG-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 136.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.50 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|