C32H42F3N7O3 — CID 173338103
4-[[(4-tert-butylcyclohexyl)-[[4-(cyclopropylmethoxy)-2-(trifluoromethyl)phenyl]carbamoyl]amino]methyl]-N-[N'-(methyldiazenyl)carbamimidoyl]benzamide (PubChem CID 173338103) has the molecular formula C32H42F3N7O3 and a molecular weight of 629.73 g/mol. Its IUPAC name is 4-[[(4-tert-butylcyclohexyl)-[[4-(cyclopropylmethoxy)-2-(trifluoromethyl)phenyl]carbamoyl]amino]methyl]-N-[N'-(methyldiazenyl)carbamimidoyl]benzamide.
| Compound Name | 4-[[(4-tert-butylcyclohexyl)-[[4-(cyclopropylmethoxy)-2-(trifluoromethyl)phenyl]carbamoyl]amino]methyl]-N-[N'-(methyldiazenyl)carbamimidoyl]benzamide |
|---|---|
| PubChem CID | 173338103 |
| Molecular Formula | C32H42F3N7O3 |
| Molecular Weight | 629.73 g/mol |
| Exact Mass | 629.33 |
| IUPAC Name | 4-[[(4-tert-butylcyclohexyl)-[[4-(cyclopropylmethoxy)-2-(trifluoromethyl)phenyl]carbamoyl]amino]methyl]-N-[N'-(methyldiazenyl)carbamimidoyl]benzamide |
| SMILES | C/N=N/N=C(N)NC(=O)c1ccc(CN(C(=O)Nc2ccc(OCC3CC3)cc2C(F)(F)F)C2CCC(C(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C32H42F3N7O3/c1-31(2,3)23-11-13-24(14-12-23)42(18-20-7-9-22(10-8-20)28(43)39-29(36)40-41-37-4)30(44)38-27-16-15-25(45-19-21-5-6-21)17-26(27)32(33,34)35/h7-10,15-17,21,23-24H,5-6,11-14,18-19H2,1-4H3,(H,38,44)(H3,36,37,39,40,43) |
| InChIKey | XDBDSOGOFZRYBX-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 133.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.73 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|