C27H31F4N5O2 — CID 171931958
N-(4-tert-butylcyclohexyl)-4-fluoro-N-[[4-[(N-iminocarbamimidoyl)carbamoyl]phenyl]methyl]-3-(trifluoromethyl)benzamide (PubChem CID 171931958) has the molecular formula C27H31F4N5O2 and a molecular weight of 533.57 g/mol. Its IUPAC name is N-(4-tert-butylcyclohexyl)-4-fluoro-N-[[4-[(N-iminocarbamimidoyl)carbamoyl]phenyl]methyl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-(4-tert-butylcyclohexyl)-4-fluoro-N-[[4-[(N-iminocarbamimidoyl)carbamoyl]phenyl]methyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 171931958 |
| Molecular Formula | C27H31F4N5O2 |
| Molecular Weight | 533.57 g/mol |
| Exact Mass | 533.24 |
| IUPAC Name | N-(4-tert-butylcyclohexyl)-4-fluoro-N-[[4-[(N-iminocarbamimidoyl)carbamoyl]phenyl]methyl]-3-(trifluoromethyl)benzamide |
| SMILES | [H]/N=C(\N=N\[H])NC(=O)c1ccc(CN(C(=O)c2ccc(F)c(C(F)(F)F)c2)C2CCC(C(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C27H31F4N5O2/c1-26(2,3)19-9-11-20(12-10-19)36(24(38)18-8-13-22(28)21(14-18)27(29,30)31)15-16-4-6-17(7-5-16)23(37)34-25(32)35-33/h4-8,13-14,19-20,33H,9-12,15H2,1-3H3,(H2,32,34,37)/b35-33+ |
| InChIKey | BQGOUXAAMNIJKI-LAPDZXRHSA-N |
| XLogP | 6.79 |
| TPSA | 109.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.57 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|