C29H38N6O2 — CID 173076058
N-(4-tert-butylcyclohexyl)-N-[[4-(formazan-3-ylcarbamoyl)phenyl]methyl]-2,3-dihydro-1H-indene-1-carboxamide (PubChem CID 173076058) has the molecular formula C29H38N6O2 and a molecular weight of 502.66 g/mol. Its IUPAC name is N-(4-tert-butylcyclohexyl)-N-[[4-(formazan-3-ylcarbamoyl)phenyl]methyl]-2,3-dihydro-1H-indene-1-carboxamide.
| Compound Name | N-(4-tert-butylcyclohexyl)-N-[[4-(formazan-3-ylcarbamoyl)phenyl]methyl]-2,3-dihydro-1H-indene-1-carboxamide |
|---|---|
| PubChem CID | 173076058 |
| Molecular Formula | C29H38N6O2 |
| Molecular Weight | 502.66 g/mol |
| Exact Mass | 502.31 |
| IUPAC Name | N-(4-tert-butylcyclohexyl)-N-[[4-(formazan-3-ylcarbamoyl)phenyl]methyl]-2,3-dihydro-1H-indene-1-carboxamide |
| SMILES | [H]/N=N/C(=NN)NC(=O)c1ccc(CN(C(=O)C2CCc3ccccc32)C2CCC(C(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C29H38N6O2/c1-29(2,3)22-13-15-23(16-14-22)35(27(37)25-17-12-20-6-4-5-7-24(20)25)18-19-8-10-21(11-9-19)26(36)32-28(33-30)34-31/h4-11,22-23,25,30H,12-18,31H2,1-3H3,(H,32,34,36)/b33-30+ |
| InChIKey | VAAZWKSIXJXVKA-KKYHWDRJSA-N |
| XLogP | 5.34 |
| TPSA | 124.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.66 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|