C33H31F3N6O4 — CID 171930776
4-[[2,2-diphenylethyl-[2-[4-(trifluoromethoxy)phenoxy]propanoyl]amino]methyl]-N-formazan-3-ylbenzamide (PubChem CID 171930776) has the molecular formula C33H31F3N6O4 and a molecular weight of 632.64 g/mol. Its IUPAC name is 4-[[2,2-diphenylethyl-[2-[4-(trifluoromethoxy)phenoxy]propanoyl]amino]methyl]-N-formazan-3-ylbenzamide.
| Compound Name | 4-[[2,2-diphenylethyl-[2-[4-(trifluoromethoxy)phenoxy]propanoyl]amino]methyl]-N-formazan-3-ylbenzamide |
|---|---|
| PubChem CID | 171930776 |
| Molecular Formula | C33H31F3N6O4 |
| Molecular Weight | 632.64 g/mol |
| Exact Mass | 632.24 |
| IUPAC Name | 4-[[2,2-diphenylethyl-[2-[4-(trifluoromethoxy)phenoxy]propanoyl]amino]methyl]-N-formazan-3-ylbenzamide |
| SMILES | [H]/N=N/C(=NN)NC(=O)c1ccc(CN(CC(c2ccccc2)c2ccccc2)C(=O)C(C)Oc2ccc(OC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C33H31F3N6O4/c1-22(45-27-16-18-28(19-17-27)46-33(34,35)36)31(44)42(20-23-12-14-26(15-13-23)30(43)39-32(40-37)41-38)21-29(24-8-4-2-5-9-24)25-10-6-3-7-11-25/h2-19,22,29,37H,20-21,38H2,1H3,(H,39,41,43)/b40-37+ |
| InChIKey | YQTALZARHYZSKI-UKRDSVFVSA-N |
| XLogP | 6.20 |
| TPSA | 142.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.64 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|