C32H42N8O4 — CID 142027014
4-[[(4-tert-butylcyclohexyl)-[(2-butyl-1,3-dioxoisoindol-5-yl)carbamoyl]amino]methyl]-N-(N'-diazenylcarbamimidoyl)benzamide (PubChem CID 142027014) has the molecular formula C32H42N8O4 and a molecular weight of 602.74 g/mol. Its IUPAC name is 4-[[(4-tert-butylcyclohexyl)-[(2-butyl-1,3-dioxoisoindol-5-yl)carbamoyl]amino]methyl]-N-(N'-diazenylcarbamimidoyl)benzamide.
| Compound Name | 4-[[(4-tert-butylcyclohexyl)-[(2-butyl-1,3-dioxoisoindol-5-yl)carbamoyl]amino]methyl]-N-(N'-diazenylcarbamimidoyl)benzamide |
|---|---|
| PubChem CID | 142027014 |
| Molecular Formula | C32H42N8O4 |
| Molecular Weight | 602.74 g/mol |
| Exact Mass | 602.33 |
| IUPAC Name | 4-[[(4-tert-butylcyclohexyl)-[(2-butyl-1,3-dioxoisoindol-5-yl)carbamoyl]amino]methyl]-N-(N'-diazenylcarbamimidoyl)benzamide |
| SMILES | [H]/N=N/N=C(N)NC(=O)c1ccc(CN(C(=O)Nc2ccc3c(c2)C(=O)N(CCCC)C3=O)C2CCC(C(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C32H42N8O4/c1-5-6-17-39-28(42)25-16-13-23(18-26(25)29(39)43)35-31(44)40(24-14-11-22(12-15-24)32(2,3)4)19-20-7-9-21(10-8-20)27(41)36-30(33)37-38-34/h7-10,13,16,18,22,24H,5-6,11-12,14-15,17,19H2,1-4H3,(H,35,44)(H4,33,34,36,37,41) |
| InChIKey | KFODXGWWPVDHOL-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 173.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.74 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|