C32H45N3O6S — CID 20584971
3-[[4-[[(4-tert-butylcyclohexyl)-[(4-butylsulfinylphenyl)carbamoyl]amino]methyl]benzoyl]amino]-2-hydroxypropanoic acid (PubChem CID 20584971) has the molecular formula C32H45N3O6S and a molecular weight of 599.79 g/mol. Its IUPAC name is 3-[[4-[[(4-tert-butylcyclohexyl)-[(4-butylsulfinylphenyl)carbamoyl]amino]methyl]benzoyl]amino]-2-hydroxypropanoic acid.
| Compound Name | 3-[[4-[[(4-tert-butylcyclohexyl)-[(4-butylsulfinylphenyl)carbamoyl]amino]methyl]benzoyl]amino]-2-hydroxypropanoic acid |
|---|---|
| PubChem CID | 20584971 |
| Molecular Formula | C32H45N3O6S |
| Molecular Weight | 599.79 g/mol |
| Exact Mass | 599.30 |
| IUPAC Name | 3-[[4-[[(4-tert-butylcyclohexyl)-[(4-butylsulfinylphenyl)carbamoyl]amino]methyl]benzoyl]amino]-2-hydroxypropanoic acid |
| SMILES | CCCCS(=O)c1ccc(NC(=O)N(Cc2ccc(C(=O)NCC(O)C(=O)O)cc2)C2CCC(C(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C32H45N3O6S/c1-5-6-19-42(41)27-17-13-25(14-18-27)34-31(40)35(26-15-11-24(12-16-26)32(2,3)4)21-22-7-9-23(10-8-22)29(37)33-20-28(36)30(38)39/h7-10,13-14,17-18,24,26,28,36H,5-6,11-12,15-16,19-21H2,1-4H3,(H,33,37)(H,34,40)(H,38,39) |
| InChIKey | XRLMBRNZYVJVRC-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 136.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.79 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |