C31H45N3O3 — CID 68909002
3-[[4-[[(4-tert-butylcyclohexyl)-[(4-propan-2-ylphenyl)carbamoyl]amino]methyl]phenyl]methylamino]propanoic acid (PubChem CID 68909002) has the molecular formula C31H45N3O3 and a molecular weight of 507.72 g/mol. Its IUPAC name is 3-[[4-[[(4-tert-butylcyclohexyl)-[(4-propan-2-ylphenyl)carbamoyl]amino]methyl]phenyl]methylamino]propanoic acid.
| Compound Name | 3-[[4-[[(4-tert-butylcyclohexyl)-[(4-propan-2-ylphenyl)carbamoyl]amino]methyl]phenyl]methylamino]propanoic acid |
|---|---|
| PubChem CID | 68909002 |
| Molecular Formula | C31H45N3O3 |
| Molecular Weight | 507.72 g/mol |
| Exact Mass | 507.35 |
| IUPAC Name | 3-[[4-[[(4-tert-butylcyclohexyl)-[(4-propan-2-ylphenyl)carbamoyl]amino]methyl]phenyl]methylamino]propanoic acid |
| SMILES | CC(C)c1ccc(NC(=O)N(Cc2ccc(CNCCC(=O)O)cc2)C2CCC(C(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C31H45N3O3/c1-22(2)25-10-14-27(15-11-25)33-30(37)34(28-16-12-26(13-17-28)31(3,4)5)21-24-8-6-23(7-9-24)20-32-19-18-29(35)36/h6-11,14-15,22,26,28,32H,12-13,16-21H2,1-5H3,(H,33,37)(H,35,36) |
| InChIKey | FVSXDOSRBJMXIB-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.72 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|