C29H39N3O6S — CID 59062517
(2R)-3-[[4-[[(4-tert-butylcyclohexyl)-[(4-methylsulfinylphenyl)carbamoyl]amino]methyl]benzoyl]amino]-2-hydroxypropanoic acid (PubChem CID 59062517) has the molecular formula C29H39N3O6S and a molecular weight of 557.71 g/mol. Its IUPAC name is (2R)-3-[[4-[[(4-tert-butylcyclohexyl)-[(4-methylsulfinylphenyl)carbamoyl]amino]methyl]benzoyl]amino]-2-hydroxypropanoic acid.
| Compound Name | (2R)-3-[[4-[[(4-tert-butylcyclohexyl)-[(4-methylsulfinylphenyl)carbamoyl]amino]methyl]benzoyl]amino]-2-hydroxypropanoic acid |
|---|---|
| PubChem CID | 59062517 |
| Molecular Formula | C29H39N3O6S |
| Molecular Weight | 557.71 g/mol |
| Exact Mass | 557.26 |
| IUPAC Name | (2R)-3-[[4-[[(4-tert-butylcyclohexyl)-[(4-methylsulfinylphenyl)carbamoyl]amino]methyl]benzoyl]amino]-2-hydroxypropanoic acid |
| SMILES | CS(=O)c1ccc(NC(=O)N(Cc2ccc(C(=O)NC[C@@H](O)C(=O)O)cc2)C2CCC(C(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C29H39N3O6S/c1-29(2,3)21-9-13-23(14-10-21)32(28(37)31-22-11-15-24(16-12-22)39(4)38)18-19-5-7-20(8-6-19)26(34)30-17-25(33)27(35)36/h5-8,11-12,15-16,21,23,25,33H,9-10,13-14,17-18H2,1-4H3,(H,30,34)(H,31,37)(H,35,36)/t21?,23?,25-,39?/m1/s1 |
| InChIKey | FMSABPWXDXEEDW-OEPPKFLXSA-N |
| XLogP | 4.24 |
| TPSA | 136.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.71 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |