C28H36F3N7O3 — CID 142027269
N-[amino-[(Z)-aminodiazenyl]methylidene]-4-[[(4-tert-butylcyclohexyl)-[[4-methoxy-3-(trifluoromethyl)phenyl]carbamoyl]amino]methyl]benzamide (PubChem CID 142027269) has the molecular formula C28H36F3N7O3 and a molecular weight of 575.64 g/mol. Its IUPAC name is N-[amino-[(Z)-aminodiazenyl]methylidene]-4-[[(4-tert-butylcyclohexyl)-[[4-methoxy-3-(trifluoromethyl)phenyl]carbamoyl]amino]methyl]benzamide.
| Compound Name | N-[amino-[(Z)-aminodiazenyl]methylidene]-4-[[(4-tert-butylcyclohexyl)-[[4-methoxy-3-(trifluoromethyl)phenyl]carbamoyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 142027269 |
| Molecular Formula | C28H36F3N7O3 |
| Molecular Weight | 575.64 g/mol |
| Exact Mass | 575.28 |
| IUPAC Name | N-[amino-[(Z)-aminodiazenyl]methylidene]-4-[[(4-tert-butylcyclohexyl)-[[4-methoxy-3-(trifluoromethyl)phenyl]carbamoyl]amino]methyl]benzamide |
| SMILES | COc1ccc(NC(=O)N(Cc2ccc(C(=O)/N=C(N)\N=N/N)cc2)C2CCC(C(C)(C)C)CC2)cc1C(F)(F)F |
| InChI | InChI=1S/C28H36F3N7O3/c1-27(2,3)19-9-12-21(13-10-19)38(16-17-5-7-18(8-6-17)24(39)35-25(32)36-37-33)26(40)34-20-11-14-23(41-4)22(15-20)28(29,30)31/h5-8,11,14-15,19,21H,9-10,12-13,16H2,1-4H3,(H,34,40)(H4,32,33,35,36,39) |
| InChIKey | HPUVOEDWFDTKCM-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 147.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.64 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|