C20H24N2O3 — CID 87009003
1-cyclopropyl-3-(3,4-dimethoxyphenyl)-1-[(3-methylphenyl)methyl]urea (PubChem CID 87009003) has the molecular formula C20H24N2O3 and a molecular weight of 340.42 g/mol. Its IUPAC name is 1-cyclopropyl-3-(3,4-dimethoxyphenyl)-1-[(3-methylphenyl)methyl]urea.
| Compound Name | 1-cyclopropyl-3-(3,4-dimethoxyphenyl)-1-[(3-methylphenyl)methyl]urea |
|---|---|
| PubChem CID | 87009003 |
| Molecular Formula | C20H24N2O3 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | 1-cyclopropyl-3-(3,4-dimethoxyphenyl)-1-[(3-methylphenyl)methyl]urea |
| SMILES | COc1ccc(NC(=O)N(Cc2cccc(C)c2)C2CC2)cc1OC |
| InChI | InChI=1S/C20H24N2O3/c1-14-5-4-6-15(11-14)13-22(17-8-9-17)20(23)21-16-7-10-18(24-2)19(12-16)25-3/h4-7,10-12,17H,8-9,13H2,1-3H3,(H,21,23) |
| InChIKey | PYHODPPSJBVZHH-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |