C19H22N2O4 — CID 60577311
1-cyclopropyl-1-[(4-hydroxy-3-methoxyphenyl)methyl]-3-(2-methoxyphenyl)urea (PubChem CID 60577311) has the molecular formula C19H22N2O4 and a molecular weight of 342.40 g/mol. Its IUPAC name is 1-cyclopropyl-1-[(4-hydroxy-3-methoxyphenyl)methyl]-3-(2-methoxyphenyl)urea.
| Compound Name | 1-cyclopropyl-1-[(4-hydroxy-3-methoxyphenyl)methyl]-3-(2-methoxyphenyl)urea |
|---|---|
| PubChem CID | 60577311 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 1-cyclopropyl-1-[(4-hydroxy-3-methoxyphenyl)methyl]-3-(2-methoxyphenyl)urea |
| SMILES | COc1cc(CN(C(=O)Nc2ccccc2OC)C2CC2)ccc1O |
| InChI | InChI=1S/C19H22N2O4/c1-24-17-6-4-3-5-15(17)20-19(23)21(14-8-9-14)12-13-7-10-16(22)18(11-13)25-2/h3-7,10-11,14,22H,8-9,12H2,1-2H3,(H,20,23) |
| InChIKey | KSPMAWRHSLQWAJ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |