C18H18ClFN2O3 — CID 60620097
3-(4-chloro-2-fluorophenyl)-1-cyclopropyl-1-[(4-hydroxy-3-methoxyphenyl)methyl]urea (PubChem CID 60620097) has the molecular formula C18H18ClFN2O3 and a molecular weight of 364.80 g/mol. Its IUPAC name is 3-(4-chloro-2-fluorophenyl)-1-cyclopropyl-1-[(4-hydroxy-3-methoxyphenyl)methyl]urea.
| Compound Name | 3-(4-chloro-2-fluorophenyl)-1-cyclopropyl-1-[(4-hydroxy-3-methoxyphenyl)methyl]urea |
|---|---|
| PubChem CID | 60620097 |
| Molecular Formula | C18H18ClFN2O3 |
| Molecular Weight | 364.80 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | 3-(4-chloro-2-fluorophenyl)-1-cyclopropyl-1-[(4-hydroxy-3-methoxyphenyl)methyl]urea |
| SMILES | COc1cc(CN(C(=O)Nc2ccc(Cl)cc2F)C2CC2)ccc1O |
| InChI | InChI=1S/C18H18ClFN2O3/c1-25-17-8-11(2-7-16(17)23)10-22(13-4-5-13)18(24)21-15-6-3-12(19)9-14(15)20/h2-3,6-9,13,23H,4-5,10H2,1H3,(H,21,24) |
| InChIKey | LJTNGIBRFWGZIJ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.80 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |