C17H17NO5S — CID 166275349
5-[cyclopropyl-[(4-hydroxy-3-methoxyphenyl)methyl]carbamoyl]thiophene-3-carboxylic acid (PubChem CID 166275349) has the molecular formula C17H17NO5S and a molecular weight of 347.39 g/mol. Its IUPAC name is 5-[cyclopropyl-[(4-hydroxy-3-methoxyphenyl)methyl]carbamoyl]thiophene-3-carboxylic acid.
| Compound Name | 5-[cyclopropyl-[(4-hydroxy-3-methoxyphenyl)methyl]carbamoyl]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 166275349 |
| Molecular Formula | C17H17NO5S |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | 5-[cyclopropyl-[(4-hydroxy-3-methoxyphenyl)methyl]carbamoyl]thiophene-3-carboxylic acid |
| SMILES | COc1cc(CN(C(=O)c2cc(C(=O)O)cs2)C2CC2)ccc1O |
| InChI | InChI=1S/C17H17NO5S/c1-23-14-6-10(2-5-13(14)19)8-18(12-3-4-12)16(20)15-7-11(9-24-15)17(21)22/h2,5-7,9,12,19H,3-4,8H2,1H3,(H,21,22) |
| InChIKey | SFLSTJAWZJVNMX-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |