C19H21ClN2O4 — CID 60620419
3-(5-chloro-2-methoxyphenyl)-1-cyclopropyl-1-[(4-hydroxy-3-methoxyphenyl)methyl]urea (PubChem CID 60620419) has the molecular formula C19H21ClN2O4 and a molecular weight of 376.84 g/mol. Its IUPAC name is 3-(5-chloro-2-methoxyphenyl)-1-cyclopropyl-1-[(4-hydroxy-3-methoxyphenyl)methyl]urea.
| Compound Name | 3-(5-chloro-2-methoxyphenyl)-1-cyclopropyl-1-[(4-hydroxy-3-methoxyphenyl)methyl]urea |
|---|---|
| PubChem CID | 60620419 |
| Molecular Formula | C19H21ClN2O4 |
| Molecular Weight | 376.84 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | 3-(5-chloro-2-methoxyphenyl)-1-cyclopropyl-1-[(4-hydroxy-3-methoxyphenyl)methyl]urea |
| SMILES | COc1cc(CN(C(=O)Nc2cc(Cl)ccc2OC)C2CC2)ccc1O |
| InChI | InChI=1S/C19H21ClN2O4/c1-25-17-8-4-13(20)10-15(17)21-19(24)22(14-5-6-14)11-12-3-7-16(23)18(9-12)26-2/h3-4,7-10,14,23H,5-6,11H2,1-2H3,(H,21,24) |
| InChIKey | FIZWHNJOYIIGDT-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.84 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |