C32H42F3N7O3 — CID 157065269
4-[[(4-tert-butylcyclohexyl)-[[4-(cyclopropylmethoxy)-3-(trifluoromethyl)phenyl]carbamoyl]amino]methyl]-N-(2H-tetrazol-5-yl)benzamide;methane (PubChem CID 157065269) has the molecular formula C32H42F3N7O3 and a molecular weight of 629.73 g/mol. Its IUPAC name is 4-[[(4-tert-butylcyclohexyl)-[[4-(cyclopropylmethoxy)-3-(trifluoromethyl)phenyl]carbamoyl]amino]methyl]-N-(2H-tetrazol-5-yl)benzamide;methane.
| Compound Name | 4-[[(4-tert-butylcyclohexyl)-[[4-(cyclopropylmethoxy)-3-(trifluoromethyl)phenyl]carbamoyl]amino]methyl]-N-(2H-tetrazol-5-yl)benzamide;methane |
|---|---|
| PubChem CID | 157065269 |
| Molecular Formula | C32H42F3N7O3 |
| Molecular Weight | 629.73 g/mol |
| Exact Mass | 629.33 |
| IUPAC Name | 4-[[(4-tert-butylcyclohexyl)-[[4-(cyclopropylmethoxy)-3-(trifluoromethyl)phenyl]carbamoyl]amino]methyl]-N-(2H-tetrazol-5-yl)benzamide;methane |
| SMILES | C.CC(C)(C)C1CCC(N(Cc2ccc(C(=O)Nc3nn[nH]n3)cc2)C(=O)Nc2ccc(OCC3CC3)c(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C31H38F3N7O3.CH4/c1-30(2,3)22-10-13-24(14-11-22)41(17-19-6-8-21(9-7-19)27(42)36-28-37-39-40-38-28)29(43)35-23-12-15-26(44-18-20-4-5-20)25(16-23)31(32,33)34;/h6-9,12,15-16,20,22,24H,4-5,10-11,13-14,17-18H2,1-3H3,(H,35,43)(H2,36,37,38,39,40,42);1H4 |
| InChIKey | ABUMZEPHEFTFGP-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 125.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.73 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |