C29H40N6O3 — CID 91562605
4-[[(4-tert-butylcyclohexyl)-(4-propan-2-yloxybenzoyl)amino]methyl]-N-(didiazenylmethyl)benzamide (PubChem CID 91562605) has the molecular formula C29H40N6O3 and a molecular weight of 520.68 g/mol. Its IUPAC name is 4-[[(4-tert-butylcyclohexyl)-(4-propan-2-yloxybenzoyl)amino]methyl]-N-(didiazenylmethyl)benzamide.
| Compound Name | 4-[[(4-tert-butylcyclohexyl)-(4-propan-2-yloxybenzoyl)amino]methyl]-N-(didiazenylmethyl)benzamide |
|---|---|
| PubChem CID | 91562605 |
| Molecular Formula | C29H40N6O3 |
| Molecular Weight | 520.68 g/mol |
| Exact Mass | 520.32 |
| IUPAC Name | 4-[[(4-tert-butylcyclohexyl)-(4-propan-2-yloxybenzoyl)amino]methyl]-N-(didiazenylmethyl)benzamide |
| SMILES | [H]/N=N/C(/N=N/[H])NC(=O)c1ccc(CN(C(=O)c2ccc(OC(C)C)cc2)C2CCC(C(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C29H40N6O3/c1-19(2)38-25-16-10-22(11-17-25)27(37)35(24-14-12-23(13-15-24)29(3,4)5)18-20-6-8-21(9-7-20)26(36)32-28(33-30)34-31/h6-11,16-17,19,23-24,28,30-31H,12-15,18H2,1-5H3,(H,32,36)/b33-30+,34-31+ |
| InChIKey | HPFIUHBDLWATBZ-MWAULZJESA-N |
| XLogP | 6.80 |
| TPSA | 131.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.68 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|