C35H36N6O2 — CID 91496280
4-benzyl-N-(4-cyclohexylphenyl)-N-[[4-(didiazenylmethylcarbamoyl)phenyl]methyl]benzamide (PubChem CID 91496280) has the molecular formula C35H36N6O2 and a molecular weight of 572.71 g/mol. Its IUPAC name is 4-benzyl-N-(4-cyclohexylphenyl)-N-[[4-(didiazenylmethylcarbamoyl)phenyl]methyl]benzamide.
| Compound Name | 4-benzyl-N-(4-cyclohexylphenyl)-N-[[4-(didiazenylmethylcarbamoyl)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 91496280 |
| Molecular Formula | C35H36N6O2 |
| Molecular Weight | 572.71 g/mol |
| Exact Mass | 572.29 |
| IUPAC Name | 4-benzyl-N-(4-cyclohexylphenyl)-N-[[4-(didiazenylmethylcarbamoyl)phenyl]methyl]benzamide |
| SMILES | [H]/N=N/C(/N=N/[H])NC(=O)c1ccc(CN(C(=O)c2ccc(Cc3ccccc3)cc2)c2ccc(C3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C35H36N6O2/c36-39-35(40-37)38-33(42)30-15-13-27(14-16-30)24-41(32-21-19-29(20-22-32)28-9-5-2-6-10-28)34(43)31-17-11-26(12-18-31)23-25-7-3-1-4-8-25/h1,3-4,7-8,11-22,28,35-37H,2,5-6,9-10,23-24H2,(H,38,42)/b39-36+,40-37+ |
| InChIKey | CFHULCHNLIHPHQ-DNCKCRQPSA-N |
| XLogP | 8.25 |
| TPSA | 121.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.71 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|