C31H37N7O2 — CID 173076089
4-[[4-cyclohexyl-N-(2-phenylethylcarbamoyl)anilino]methyl]-N-[N'-(methyldiazenyl)carbamimidoyl]benzamide (PubChem CID 173076089) has the molecular formula C31H37N7O2 and a molecular weight of 539.68 g/mol. Its IUPAC name is 4-[[4-cyclohexyl-N-(2-phenylethylcarbamoyl)anilino]methyl]-N-[N'-(methyldiazenyl)carbamimidoyl]benzamide.
| Compound Name | 4-[[4-cyclohexyl-N-(2-phenylethylcarbamoyl)anilino]methyl]-N-[N'-(methyldiazenyl)carbamimidoyl]benzamide |
|---|---|
| PubChem CID | 173076089 |
| Molecular Formula | C31H37N7O2 |
| Molecular Weight | 539.68 g/mol |
| Exact Mass | 539.30 |
| IUPAC Name | 4-[[4-cyclohexyl-N-(2-phenylethylcarbamoyl)anilino]methyl]-N-[N'-(methyldiazenyl)carbamimidoyl]benzamide |
| SMILES | C/N=N/N=C(N)NC(=O)c1ccc(CN(C(=O)NCCc2ccccc2)c2ccc(C3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C31H37N7O2/c1-33-37-36-30(32)35-29(39)27-14-12-24(13-15-27)22-38(31(40)34-21-20-23-8-4-2-5-9-23)28-18-16-26(17-19-28)25-10-6-3-7-11-25/h2,4-5,8-9,12-19,25H,3,6-7,10-11,20-22H2,1H3,(H,34,40)(H3,32,33,35,36,39) |
| InChIKey | AKAGAUSBCQDESQ-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 124.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.68 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|