C32H38N6O2 — CID 142027346
N-[(Z)-N-amino-N-methylcarbamohydrazonoyl]-4-[(4-cyclohexyl-N-[(E)-3-(2-methylphenyl)prop-2-enoyl]anilino)methyl]benzamide (PubChem CID 142027346) has the molecular formula C32H38N6O2 and a molecular weight of 538.70 g/mol. Its IUPAC name is N-[(Z)-N-amino-N-methylcarbamohydrazonoyl]-4-[(4-cyclohexyl-N-[(E)-3-(2-methylphenyl)prop-2-enoyl]anilino)methyl]benzamide.
| Compound Name | N-[(Z)-N-amino-N-methylcarbamohydrazonoyl]-4-[(4-cyclohexyl-N-[(E)-3-(2-methylphenyl)prop-2-enoyl]anilino)methyl]benzamide |
|---|---|
| PubChem CID | 142027346 |
| Molecular Formula | C32H38N6O2 |
| Molecular Weight | 538.70 g/mol |
| Exact Mass | 538.31 |
| IUPAC Name | N-[(Z)-N-amino-N-methylcarbamohydrazonoyl]-4-[(4-cyclohexyl-N-[(E)-3-(2-methylphenyl)prop-2-enoyl]anilino)methyl]benzamide |
| SMILES | Cc1ccccc1/C=C/C(=O)N(Cc1ccc(C(=O)N/C(=N/N)N(C)N)cc1)c1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C32H38N6O2/c1-23-8-6-7-9-25(23)18-21-30(39)38(29-19-16-27(17-20-29)26-10-4-3-5-11-26)22-24-12-14-28(15-13-24)31(40)35-32(36-33)37(2)34/h6-9,12-21,26H,3-5,10-11,22,33-34H2,1-2H3,(H,35,36,40)/b21-18+ |
| InChIKey | CMRDIIUDUVTFIG-DYTRJAOYSA-N |
| XLogP | 5.05 |
| TPSA | 117.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.70 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|