C26H27N7O4S2 — CID 59117007
5-[[(4-cyclohexylphenyl)-[[4-(2H-tetrazol-5-ylcarbamoyl)phenyl]methyl]carbamoyl]amino]thiophene-2-sulfinic acid (PubChem CID 59117007) has the molecular formula C26H27N7O4S2 and a molecular weight of 565.68 g/mol. Its IUPAC name is 5-[[(4-cyclohexylphenyl)-[[4-(2H-tetrazol-5-ylcarbamoyl)phenyl]methyl]carbamoyl]amino]thiophene-2-sulfinic acid.
| Compound Name | 5-[[(4-cyclohexylphenyl)-[[4-(2H-tetrazol-5-ylcarbamoyl)phenyl]methyl]carbamoyl]amino]thiophene-2-sulfinic acid |
|---|---|
| PubChem CID | 59117007 |
| Molecular Formula | C26H27N7O4S2 |
| Molecular Weight | 565.68 g/mol |
| Exact Mass | 565.16 |
| IUPAC Name | 5-[[(4-cyclohexylphenyl)-[[4-(2H-tetrazol-5-ylcarbamoyl)phenyl]methyl]carbamoyl]amino]thiophene-2-sulfinic acid |
| SMILES | O=C(Nc1nn[nH]n1)c1ccc(CN(C(=O)Nc2ccc(S(=O)O)s2)c2ccc(C3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C26H27N7O4S2/c34-24(28-25-29-31-32-30-25)20-8-6-17(7-9-20)16-33(26(35)27-22-14-15-23(38-22)39(36)37)21-12-10-19(11-13-21)18-4-2-1-3-5-18/h6-15,18H,1-5,16H2,(H,27,35)(H,36,37)(H2,28,29,30,31,32,34) |
| InChIKey | VTYCYSIOASVAJZ-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 153.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.68 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|