C30H35N5O2S — CID 142027416
4-[[4-(cyclohexen-1-yl)-N-formylanilino]methyl]-N-(diaminomethylidene)benzamide;N-methyl-3-methylsulfanylaniline (PubChem CID 142027416) has the molecular formula C30H35N5O2S and a molecular weight of 529.71 g/mol. Its IUPAC name is 4-[[4-(cyclohexen-1-yl)-N-formylanilino]methyl]-N-(diaminomethylidene)benzamide;N-methyl-3-methylsulfanylaniline.
| Compound Name | 4-[[4-(cyclohexen-1-yl)-N-formylanilino]methyl]-N-(diaminomethylidene)benzamide;N-methyl-3-methylsulfanylaniline |
|---|---|
| PubChem CID | 142027416 |
| Molecular Formula | C30H35N5O2S |
| Molecular Weight | 529.71 g/mol |
| Exact Mass | 529.25 |
| IUPAC Name | 4-[[4-(cyclohexen-1-yl)-N-formylanilino]methyl]-N-(diaminomethylidene)benzamide;N-methyl-3-methylsulfanylaniline |
| SMILES | CNc1cccc(SC)c1.NC(N)=NC(=O)c1ccc(CN(C=O)c2ccc(C3=CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C22H24N4O2.C8H11NS/c23-22(24)25-21(28)19-8-6-16(7-9-19)14-26(15-27)20-12-10-18(11-13-20)17-4-2-1-3-5-17;1-9-7-4-3-5-8(6-7)10-2/h4,6-13,15H,1-3,5,14H2,(H4,23,24,25,28);3-6,9H,1-2H3 |
| InChIKey | LAOUITXGCBINBD-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.71 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|