C27H28N6O — CID 174437269
1-(4-cyclohexylphenyl)-3-phenyl-1-[[4-(2H-tetrazol-5-yl)phenyl]methyl]urea (PubChem CID 174437269) has the molecular formula C27H28N6O and a molecular weight of 452.56 g/mol. Its IUPAC name is 1-(4-cyclohexylphenyl)-3-phenyl-1-[[4-(2H-tetrazol-5-yl)phenyl]methyl]urea.
| Compound Name | 1-(4-cyclohexylphenyl)-3-phenyl-1-[[4-(2H-tetrazol-5-yl)phenyl]methyl]urea |
|---|---|
| PubChem CID | 174437269 |
| Molecular Formula | C27H28N6O |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | 1-(4-cyclohexylphenyl)-3-phenyl-1-[[4-(2H-tetrazol-5-yl)phenyl]methyl]urea |
| SMILES | O=C(Nc1ccccc1)N(Cc1ccc(-c2nn[nH]n2)cc1)c1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C27H28N6O/c34-27(28-24-9-5-2-6-10-24)33(19-20-11-13-23(14-12-20)26-29-31-32-30-26)25-17-15-22(16-18-25)21-7-3-1-4-8-21/h2,5-6,9-18,21H,1,3-4,7-8,19H2,(H,28,34)(H,29,30,31,32) |
| InChIKey | ZXCBEUVWYWUDMQ-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |