C29H29Cl2N9O — CID 67489112
4-[[N-[N'-(aminomethyl)-N-(3,5-dichlorophenyl)carbamimidoyl]-4-(cyclohexen-1-yl)anilino]methyl]-N-(2H-tetrazol-5-yl)benzamide (PubChem CID 67489112) has the molecular formula C29H29Cl2N9O and a molecular weight of 590.52 g/mol. Its IUPAC name is 4-[[N-[N'-(aminomethyl)-N-(3,5-dichlorophenyl)carbamimidoyl]-4-(cyclohexen-1-yl)anilino]methyl]-N-(2H-tetrazol-5-yl)benzamide.
| Compound Name | 4-[[N-[N'-(aminomethyl)-N-(3,5-dichlorophenyl)carbamimidoyl]-4-(cyclohexen-1-yl)anilino]methyl]-N-(2H-tetrazol-5-yl)benzamide |
|---|---|
| PubChem CID | 67489112 |
| Molecular Formula | C29H29Cl2N9O |
| Molecular Weight | 590.52 g/mol |
| Exact Mass | 589.19 |
| IUPAC Name | 4-[[N-[N'-(aminomethyl)-N-(3,5-dichlorophenyl)carbamimidoyl]-4-(cyclohexen-1-yl)anilino]methyl]-N-(2H-tetrazol-5-yl)benzamide |
| SMILES | NCN=C(Nc1cc(Cl)cc(Cl)c1)N(Cc1ccc(C(=O)Nc2nn[nH]n2)cc1)c1ccc(C2=CCCCC2)cc1 |
| InChI | InChI=1S/C29H29Cl2N9O/c30-23-14-24(31)16-25(15-23)34-29(33-18-32)40(26-12-10-21(11-13-26)20-4-2-1-3-5-20)17-19-6-8-22(9-7-19)27(41)35-28-36-38-39-37-28/h4,6-16H,1-3,5,17-18,32H2,(H,33,34)(H2,35,36,37,38,39,41) |
| InChIKey | UQYFEKOXQCQVNQ-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 137.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.52 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|