C31H31F3N4O4 — CID 67489096
3-[[4-[[4-(cyclohexen-1-yl)-N-[N'-[4-(trifluoromethoxy)phenyl]carbamimidoyl]anilino]methyl]benzoyl]amino]propanoic acid (PubChem CID 67489096) has the molecular formula C31H31F3N4O4 and a molecular weight of 580.61 g/mol. Its IUPAC name is 3-[[4-[[4-(cyclohexen-1-yl)-N-[N'-[4-(trifluoromethoxy)phenyl]carbamimidoyl]anilino]methyl]benzoyl]amino]propanoic acid.
| Compound Name | 3-[[4-[[4-(cyclohexen-1-yl)-N-[N'-[4-(trifluoromethoxy)phenyl]carbamimidoyl]anilino]methyl]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 67489096 |
| Molecular Formula | C31H31F3N4O4 |
| Molecular Weight | 580.61 g/mol |
| Exact Mass | 580.23 |
| IUPAC Name | 3-[[4-[[4-(cyclohexen-1-yl)-N-[N'-[4-(trifluoromethoxy)phenyl]carbamimidoyl]anilino]methyl]benzoyl]amino]propanoic acid |
| SMILES | N/C(=N\c1ccc(OC(F)(F)F)cc1)N(Cc1ccc(C(=O)NCCC(=O)O)cc1)c1ccc(C2=CCCCC2)cc1 |
| InChI | InChI=1S/C31H31F3N4O4/c32-31(33,34)42-27-16-12-25(13-17-27)37-30(35)38(26-14-10-23(11-15-26)22-4-2-1-3-5-22)20-21-6-8-24(9-7-21)29(41)36-19-18-28(39)40/h4,6-17H,1-3,5,18-20H2,(H2,35,37)(H,36,41)(H,39,40) |
| InChIKey | GZSZMTIGSJQIRJ-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 117.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.61 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|