About 3-phenyl-1-(pyridin-4-ylmethyl)-1-(2-sulfanylidene-3H-1,3-benzothiazol-6-yl)urea
3-phenyl-1-(pyridin-4-ylmethyl)-1-(2-sulfanylidene-3H-1,3-benzothiazol-6-yl)urea (PubChem CID 141055348) has the molecular formula C20H16N4OS2
and a molecular weight of 392.51 g/mol. Its IUPAC name is 3-phenyl-1-(pyridin-4-ylmethyl)-1-(2-sulfanylidene-3H-1,3-benzothiazol-6-yl)urea.
Molecular Properties
| Compound Name | 3-phenyl-1-(pyridin-4-ylmethyl)-1-(2-sulfanylidene-3H-1,3-benzothiazol-6-yl)urea |
| PubChem CID | 141055348 |
| Molecular Formula | C20H16N4OS2 |
| Molecular Weight | 392.51 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | 3-phenyl-1-(pyridin-4-ylmethyl)-1-(2-sulfanylidene-3H-1,3-benzothiazol-6-yl)urea |
| SMILES | O=C(Nc1ccccc1)N(Cc1ccncc1)c1ccc2[nH]c(=S)sc2c1 |
| InChI | InChI=1S/C20H16N4OS2/c25-19(22-15-4-2-1-3-5-15)24(13-14-8-10-21-11-9-14)16-6-7-17-18(12-16)27-20(26)23-17/h1-12H,13H2,(H,22,25)(H,23,26) |
| InChIKey | NUAFAMYUXSIIQM-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 392.51 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-phenyl-1-(pyridin-4-ylmethyl)-1-(2-sulfanylidene-3H-1,3-benzothiazol-6-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenyl-1-(pyridin-4-ylmethyl)-1-(2-sulfanylidene-3H-1,3-benzothiazol-6-yl)urea?
The IUPAC name of 3-phenyl-1-(pyridin-4-ylmethyl)-1-(2-sulfanylidene-3H-1,3-benzothiazol-6-yl)urea (CID 141055348) is 3-phenyl-1-(pyridin-4-ylmethyl)-1-(2-sulfanylidene-3H-1,3-benzothiazol-6-yl)urea.
What is the SMILES notation for 3-phenyl-1-(pyridin-4-ylmethyl)-1-(2-sulfanylidene-3H-1,3-benzothiazol-6-yl)urea?
The canonical SMILES for 3-phenyl-1-(pyridin-4-ylmethyl)-1-(2-sulfanylidene-3H-1,3-benzothiazol-6-yl)urea is O=C(Nc1ccccc1)N(Cc1ccncc1)c1ccc2[nH]c(=S)sc2c1.
What is the InChIKey of 3-phenyl-1-(pyridin-4-ylmethyl)-1-(2-sulfanylidene-3H-1,3-benzothiazol-6-yl)urea?
The InChIKey is NUAFAMYUXSIIQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16N4OS2/c25-19(22-15-4-2-1-3-5-15)24(13-14-8-10-21-11-9-14)16-6-7-17-18(12-16)27-20(26)23-17/h1-12H,13H2,(H,22,25)(H,23,26).
What are the key properties of 3-phenyl-1-(pyridin-4-ylmethyl)-1-(2-sulfanylidene-3H-1,3-benzothiazol-6-yl)urea?
3-phenyl-1-(pyridin-4-ylmethyl)-1-(2-sulfanylidene-3H-1,3-benzothiazol-6-yl)urea has a molecular weight of 392.51 g/mol, XLogP of 5.59, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenyl-1-(pyridin-4-ylmethyl)-1-(2-sulfanylidene-3H-1,3-benzothiazol-6-yl)urea is sourced from PubChem (CID 141055348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).