C20H16N4OS2 — CID 141055348
3-phenyl-1-(pyridin-4-ylmethyl)-1-(2-sulfanylidene-3H-1,3-benzothiazol-6-yl)urea (PubChem CID 141055348) has the molecular formula C20H16N4OS2 and a molecular weight of 392.51 g/mol. Its IUPAC name is 3-phenyl-1-(pyridin-4-ylmethyl)-1-(2-sulfanylidene-3H-1,3-benzothiazol-6-yl)urea.
| Compound Name | 3-phenyl-1-(pyridin-4-ylmethyl)-1-(2-sulfanylidene-3H-1,3-benzothiazol-6-yl)urea |
|---|---|
| PubChem CID | 141055348 |
| Molecular Formula | C20H16N4OS2 |
| Molecular Weight | 392.51 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | 3-phenyl-1-(pyridin-4-ylmethyl)-1-(2-sulfanylidene-3H-1,3-benzothiazol-6-yl)urea |
| SMILES | O=C(Nc1ccccc1)N(Cc1ccncc1)c1ccc2[nH]c(=S)sc2c1 |
| InChI | InChI=1S/C20H16N4OS2/c25-19(22-15-4-2-1-3-5-15)24(13-14-8-10-21-11-9-14)16-6-7-17-18(12-16)27-20(26)23-17/h1-12H,13H2,(H,22,25)(H,23,26) |
| InChIKey | NUAFAMYUXSIIQM-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.51 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|