C19H21N3OS — CID 15322982
1-benzyl-3-phenyl-1-(4,5,6,7-tetrahydro-1,3-thiazepin-2-yl)urea (PubChem CID 15322982) has the molecular formula C19H21N3OS and a molecular weight of 339.46 g/mol. Its IUPAC name is 1-benzyl-3-phenyl-1-(4,5,6,7-tetrahydro-1,3-thiazepin-2-yl)urea.
| Compound Name | 1-benzyl-3-phenyl-1-(4,5,6,7-tetrahydro-1,3-thiazepin-2-yl)urea |
|---|---|
| PubChem CID | 15322982 |
| Molecular Formula | C19H21N3OS |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | 1-benzyl-3-phenyl-1-(4,5,6,7-tetrahydro-1,3-thiazepin-2-yl)urea |
| SMILES | O=C(Nc1ccccc1)N(Cc1ccccc1)C1=NCCCCS1 |
| InChI | InChI=1S/C19H21N3OS/c23-18(21-17-11-5-2-6-12-17)22(15-16-9-3-1-4-10-16)19-20-13-7-8-14-24-19/h1-6,9-12H,7-8,13-15H2,(H,21,23) |
| InChIKey | TXWJYOYDYDXTAT-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |